C38H27ClFN3O7 — CID 4174648
8-(3-chlorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-2-(3-nitrophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4174648) has the molecular formula C38H27ClFN3O7 and a molecular weight of 692.10 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-2-(3-nitrophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chlorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-2-(3-nitrophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4174648 |
| Molecular Formula | C38H27ClFN3O7 |
| Molecular Weight | 692.10 g/mol |
| Exact Mass | 691.15 |
| IUPAC Name | 8-(3-chlorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-2-(3-nitrophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5cccc(Cl)c5)C(=O)C4(c4ccccc4)C3c3ccc(O)c(F)c3)C2C(=O)N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C38H27ClFN3O7/c39-22-8-4-9-23(17-22)42-35(46)29-19-28-26(13-14-27-32(28)36(47)41(34(27)45)24-10-5-11-25(18-24)43(49)50)33(20-12-15-31(44)30(40)16-20)38(29,37(42)48)21-6-2-1-3-7-21/h1-13,15-18,27-29,32-33,44H,14,19H2 |
| InChIKey | AVAYCZPVVFVUCG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.10 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|