C40H32ClN3O8 — CID 3315193
8-(3-chlorophenyl)-6-(3-ethoxy-4-hydroxyphenyl)-2-(3-nitrophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3315193) has the molecular formula C40H32ClN3O8 and a molecular weight of 718.16 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-6-(3-ethoxy-4-hydroxyphenyl)-2-(3-nitrophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chlorophenyl)-6-(3-ethoxy-4-hydroxyphenyl)-2-(3-nitrophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3315193 |
| Molecular Formula | C40H32ClN3O8 |
| Molecular Weight | 718.16 g/mol |
| Exact Mass | 717.19 |
| IUPAC Name | 8-(3-chlorophenyl)-6-(3-ethoxy-4-hydroxyphenyl)-2-(3-nitrophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(c5cccc([N+](=O)[O-])c5)C(=O)C4C3CC3C(=O)N(c4cccc(Cl)c4)C(=O)C32c2ccccc2)ccc1O |
| InChI | InChI=1S/C40H32ClN3O8/c1-2-52-33-18-22(14-17-32(33)45)35-28-15-16-29-34(38(48)42(36(29)46)26-12-7-13-27(20-26)44(50)51)30(28)21-31-37(47)43(25-11-6-10-24(41)19-25)39(49)40(31,35)23-8-4-3-5-9-23/h3-15,17-20,29-31,34-35,45H,2,16,21H2,1H3 |
| InChIKey | RELHFNLBHFMTNF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.16 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|