C41H34Cl2N2O6 — CID 5061903
2-(3-chloro-4-methylphenyl)-8-(3-chlorophenyl)-6-(3-ethoxy-4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5061903) has the molecular formula C41H34Cl2N2O6 and a molecular weight of 721.64 g/mol. Its IUPAC name is 2-(3-chloro-4-methylphenyl)-8-(3-chlorophenyl)-6-(3-ethoxy-4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(3-chloro-4-methylphenyl)-8-(3-chlorophenyl)-6-(3-ethoxy-4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5061903 |
| Molecular Formula | C41H34Cl2N2O6 |
| Molecular Weight | 721.64 g/mol |
| Exact Mass | 720.18 |
| IUPAC Name | 2-(3-chloro-4-methylphenyl)-8-(3-chlorophenyl)-6-(3-ethoxy-4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(c5ccc(C)c(Cl)c5)C(=O)C4C3CC3C(=O)N(c4cccc(Cl)c4)C(=O)C32c2ccccc2)ccc1O |
| InChI | InChI=1S/C41H34Cl2N2O6/c1-3-51-34-18-23(13-17-33(34)46)36-28-15-16-29-35(39(49)44(37(29)47)27-14-12-22(2)32(43)20-27)30(28)21-31-38(48)45(26-11-7-10-25(42)19-26)40(50)41(31,36)24-8-5-4-6-9-24/h4-15,17-20,29-31,35-36,46H,3,16,21H2,1-2H3 |
| InChIKey | BXVSQMUPRHRAQR-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.64 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|