C34H26ClFN2O7 — CID 5086586
methyl 8-(3-chlorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 5086586) has the molecular formula C34H26ClFN2O7 and a molecular weight of 629.04 g/mol. Its IUPAC name is methyl 8-(3-chlorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 8-(3-chlorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 5086586 |
| Molecular Formula | C34H26ClFN2O7 |
| Molecular Weight | 629.04 g/mol |
| Exact Mass | 628.14 |
| IUPAC Name | methyl 8-(3-chlorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4C(=O)N(c5cccc(Cl)c5)C(=O)C4(c4ccccc4)C3c3ccc(O)c(F)c3)C2C1=O |
| InChI | InChI=1S/C34H26ClFN2O7/c1-45-33(44)38-29(40)22-12-11-21-23(27(22)31(38)42)16-24-30(41)37(20-9-5-8-19(35)15-20)32(43)34(24,18-6-3-2-4-7-18)28(21)17-10-13-26(39)25(36)14-17/h2-11,13-15,22-24,27-28,39H,12,16H2,1H3 |
| InChIKey | ORORHMBZRPKXKK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.04 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|