C33H27ClN2O8 — CID 5071149
methyl 8-(3-chlorophenyl)-6-[5-(hydroxymethyl)furan-2-yl]-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 5071149) has the molecular formula C33H27ClN2O8 and a molecular weight of 615.04 g/mol. Its IUPAC name is methyl 8-(3-chlorophenyl)-6-[5-(hydroxymethyl)furan-2-yl]-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 8-(3-chlorophenyl)-6-[5-(hydroxymethyl)furan-2-yl]-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 5071149 |
| Molecular Formula | C33H27ClN2O8 |
| Molecular Weight | 615.04 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | methyl 8-(3-chlorophenyl)-6-[5-(hydroxymethyl)furan-2-yl]-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4C(=O)N(c5cccc(Cl)c5)C(=O)C4(c4ccccc4)C3c3ccc(CO)o3)C2C1=O |
| InChI | InChI=1S/C33H27ClN2O8/c1-43-32(42)36-28(38)22-12-11-21-23(26(22)30(36)40)15-24-29(39)35(19-9-5-8-18(34)14-19)31(41)33(24,17-6-3-2-4-7-17)27(21)25-13-10-20(16-37)44-25/h2-11,13-14,22-24,26-27,37H,12,15-16H2,1H3 |
| InChIKey | KARQDIFOOUMSHH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.04 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|