C37H28BrClN2O6 — CID 5075863
2-(4-bromophenyl)-8-(3-chlorophenyl)-6-[5-(hydroxymethyl)furan-2-yl]-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5075863) has the molecular formula C37H28BrClN2O6 and a molecular weight of 712.00 g/mol. Its IUPAC name is 2-(4-bromophenyl)-8-(3-chlorophenyl)-6-[5-(hydroxymethyl)furan-2-yl]-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-bromophenyl)-8-(3-chlorophenyl)-6-[5-(hydroxymethyl)furan-2-yl]-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5075863 |
| Molecular Formula | C37H28BrClN2O6 |
| Molecular Weight | 712.00 g/mol |
| Exact Mass | 710.08 |
| IUPAC Name | 2-(4-bromophenyl)-8-(3-chlorophenyl)-6-[5-(hydroxymethyl)furan-2-yl]-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5cccc(Cl)c5)C(=O)C4(c4ccccc4)C3c3ccc(CO)o3)C2C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C37H28BrClN2O6/c38-21-9-11-23(12-10-21)40-33(43)27-15-14-26-28(31(27)35(40)45)18-29-34(44)41(24-8-4-7-22(39)17-24)36(46)37(29,20-5-2-1-3-6-20)32(26)30-16-13-25(19-42)47-30/h1-14,16-17,27-29,31-32,42H,15,18-19H2 |
| InChIKey | UESIHXSZIVPOFQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.00 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|