C38H33N3O6 — CID 6653659
(3aS,6S,6aS,9aR,10aS,10bR)-6-[5-(hydroxymethyl)furan-2-yl]-8-(4-methylanilino)-2,6a-diphenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6653659) has the molecular formula C38H33N3O6 and a molecular weight of 627.70 g/mol. Its IUPAC name is (3aS,6S,6aS,9aR,10aS,10bR)-6-[5-(hydroxymethyl)furan-2-yl]-8-(4-methylanilino)-2,6a-diphenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6S,6aS,9aR,10aS,10bR)-6-[5-(hydroxymethyl)furan-2-yl]-8-(4-methylanilino)-2,6a-diphenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6653659 |
| Molecular Formula | C38H33N3O6 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | (3aS,6S,6aS,9aR,10aS,10bR)-6-[5-(hydroxymethyl)furan-2-yl]-8-(4-methylanilino)-2,6a-diphenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1ccc(NN2C(=O)[C@@H]3C[C@@H]4C(=CC[C@@H]5C(=O)N(c6ccccc6)C(=O)[C@@H]54)[C@H](c4ccc(CO)o4)[C@]3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C38H33N3O6/c1-22-12-14-24(15-13-22)39-41-35(44)30-20-29-27(17-18-28-32(29)36(45)40(34(28)43)25-10-6-3-7-11-25)33(31-19-16-26(21-42)47-31)38(30,37(41)46)23-8-4-2-5-9-23/h2-17,19,28-30,32-33,39,42H,18,20-21H2,1H3/t28-,29+,30-,32-,33+,38+/m0/s1 |
| InChIKey | FQIVORGUYOUACD-WZWNWFHQSA-N |
| XLogP | 5.27 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|