C36H35N3O8 — CID 3533244
4-[6-[5-(hydroxymethyl)furan-2-yl]-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 3533244) has the molecular formula C36H35N3O8 and a molecular weight of 637.69 g/mol. Its IUPAC name is 4-[6-[5-(hydroxymethyl)furan-2-yl]-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6-[5-(hydroxymethyl)furan-2-yl]-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 3533244 |
| Molecular Formula | C36H35N3O8 |
| Molecular Weight | 637.69 g/mol |
| Exact Mass | 637.24 |
| IUPAC Name | 4-[6-[5-(hydroxymethyl)furan-2-yl]-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | Cc1ccc(NN2C(=O)C3CC4C(=CCC5C(=O)N(CCCC(=O)O)C(=O)C54)C(c4ccc(CO)o4)C3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C36H35N3O8/c1-20-9-11-22(12-10-20)37-39-33(44)27-18-26-24(14-15-25-30(26)34(45)38(32(25)43)17-5-8-29(41)42)31(28-16-13-23(19-40)47-28)36(27,35(39)46)21-6-3-2-4-7-21/h2-4,6-7,9-14,16,25-27,30-31,37,40H,5,8,15,17-19H2,1H3,(H,41,42) |
| InChIKey | RJAWXZVMNHBSEO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 157.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|