C41H43N3O9 — CID 3692973
6-[6-(4-hydroxy-3,5-dimethoxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid (PubChem CID 3692973) has the molecular formula C41H43N3O9 and a molecular weight of 721.81 g/mol. Its IUPAC name is 6-[6-(4-hydroxy-3,5-dimethoxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[6-(4-hydroxy-3,5-dimethoxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 3692973 |
| Molecular Formula | C41H43N3O9 |
| Molecular Weight | 721.81 g/mol |
| Exact Mass | 721.30 |
| IUPAC Name | 6-[6-(4-hydroxy-3,5-dimethoxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(CCCCCC(=O)O)C(=O)C4C3CC3C(=O)N(Nc4ccc(C)cc4)C(=O)C32c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C41H43N3O9/c1-23-13-15-26(16-14-23)42-44-38(49)30-22-29-27(17-18-28-34(29)39(50)43(37(28)48)19-9-5-8-12-33(45)46)35(24-20-31(52-2)36(47)32(21-24)53-3)41(30,40(44)51)25-10-6-4-7-11-25/h4,6-7,10-11,13-17,20-21,28-30,34-35,42,47H,5,8-9,12,18-19,22H2,1-3H3,(H,45,46) |
| InChIKey | FAZNYASKQJQUAD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 162.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.81 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|