C39H36Cl2FN3O8 — CID 3620092
6-[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid (PubChem CID 3620092) has the molecular formula C39H36Cl2FN3O8 and a molecular weight of 764.63 g/mol. Its IUPAC name is 6-[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 3620092 |
| Molecular Formula | C39H36Cl2FN3O8 |
| Molecular Weight | 764.63 g/mol |
| Exact Mass | 763.19 |
| IUPAC Name | 6-[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(CCCCCC(=O)O)C(=O)C4C3CC3C(=O)N(Nc4ccc(F)cc4)C(=O)C32c2ccc(Cl)cc2)cc(Cl)c1O |
| InChI | InChI=1S/C39H36Cl2FN3O8/c1-53-30-18-20(17-29(41)34(30)48)33-25-14-15-26-32(37(51)44(35(26)49)16-4-2-3-5-31(46)47)27(25)19-28-36(50)45(43-24-12-10-23(42)11-13-24)38(52)39(28,33)21-6-8-22(40)9-7-21/h6-14,17-18,26-28,32-33,43,48H,2-5,15-16,19H2,1H3,(H,46,47) |
| InChIKey | GSMCFVOTQKQDDC-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|