C37H32BrClFN3O8 — CID 5188641
4-[6-(5-bromo-2-hydroxy-3-methoxyphenyl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 5188641) has the molecular formula C37H32BrClFN3O8 and a molecular weight of 781.03 g/mol. Its IUPAC name is 4-[6-(5-bromo-2-hydroxy-3-methoxyphenyl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6-(5-bromo-2-hydroxy-3-methoxyphenyl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 5188641 |
| Molecular Formula | C37H32BrClFN3O8 |
| Molecular Weight | 781.03 g/mol |
| Exact Mass | 779.10 |
| IUPAC Name | 4-[6-(5-bromo-2-hydroxy-3-methoxyphenyl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | COc1cc(Br)cc(C2C3=CCC4C(=O)N(CCCC(=O)O)C(=O)C4C3CC3C(=O)N(Nc4ccc(F)cc4)C(=O)C32c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C37H32BrClFN3O8/c1-51-28-16-19(38)15-26(32(28)46)31-23-12-13-24-30(35(49)42(33(24)47)14-2-3-29(44)45)25(23)17-27-34(48)43(41-22-10-8-21(40)9-11-22)36(50)37(27,31)18-4-6-20(39)7-5-18/h4-12,15-16,24-25,27,30-31,41,46H,2-3,13-14,17H2,1H3,(H,44,45) |
| InChIKey | DIIONNWMHDASEJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.03 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|