C36H31ClFN3O8 — CID 3707433
3-[6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxy-3-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 3707433) has the molecular formula C36H31ClFN3O8 and a molecular weight of 688.11 g/mol. Its IUPAC name is 3-[6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxy-3-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxy-3-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 3707433 |
| Molecular Formula | C36H31ClFN3O8 |
| Molecular Weight | 688.11 g/mol |
| Exact Mass | 687.18 |
| IUPAC Name | 3-[6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxy-3-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(CCC(=O)O)C(=O)C4C3CC3C(=O)N(Nc4ccc(F)cc4)C(=O)C32c2ccc(Cl)cc2)ccc1O |
| InChI | InChI=1S/C36H31ClFN3O8/c1-49-28-16-18(2-13-27(28)42)31-23-11-12-24-30(34(47)40(32(24)45)15-14-29(43)44)25(23)17-26-33(46)41(39-22-9-7-21(38)8-10-22)35(48)36(26,31)19-3-5-20(37)6-4-19/h2-11,13,16,24-26,30-31,39,42H,12,14-15,17H2,1H3,(H,43,44) |
| InChIKey | BUCGFINHEXTCCP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.11 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|