C37H33ClFN3O8 — CID 3574423
3-[6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-[4-(2-hydroxyethoxy)phenyl]-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 3574423) has the molecular formula C37H33ClFN3O8 and a molecular weight of 702.14 g/mol. Its IUPAC name is 3-[6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-[4-(2-hydroxyethoxy)phenyl]-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-[4-(2-hydroxyethoxy)phenyl]-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 3574423 |
| Molecular Formula | C37H33ClFN3O8 |
| Molecular Weight | 702.14 g/mol |
| Exact Mass | 701.19 |
| IUPAC Name | 3-[6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-[4-(2-hydroxyethoxy)phenyl]-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C2CC=C3C(CC4C(=O)N(Nc5ccc(F)cc5)C(=O)C4(c4ccc(Cl)cc4)C3c3ccc(OCCO)cc3)C2C1=O |
| InChI | InChI=1S/C37H33ClFN3O8/c38-22-5-3-21(4-6-22)37-29(34(47)42(36(37)49)40-24-9-7-23(39)8-10-24)19-28-26(32(37)20-1-11-25(12-2-20)50-18-17-43)13-14-27-31(28)35(48)41(33(27)46)16-15-30(44)45/h1-13,27-29,31-32,40,43H,14-19H2,(H,44,45) |
| InChIKey | GNWWFWWNYRFLRR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.14 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|