C40H41N3O7 — CID 4218992
6-[6-(2-hydroxy-3-methylphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid (PubChem CID 4218992) has the molecular formula C40H41N3O7 and a molecular weight of 675.78 g/mol. Its IUPAC name is 6-[6-(2-hydroxy-3-methylphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[6-(2-hydroxy-3-methylphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 4218992 |
| Molecular Formula | C40H41N3O7 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.29 |
| IUPAC Name | 6-[6-(2-hydroxy-3-methylphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
| SMILES | Cc1ccc(NN2C(=O)C3CC4C(=CCC5C(=O)N(CCCCCC(=O)O)C(=O)C54)C(c4cccc(C)c4O)C3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C40H41N3O7/c1-23-15-17-26(18-16-23)41-43-37(48)31-22-30-27(19-20-28-33(30)38(49)42(36(28)47)21-8-4-7-14-32(44)45)34(29-13-9-10-24(2)35(29)46)40(31,39(43)50)25-11-5-3-6-12-25/h3,5-6,9-13,15-19,28,30-31,33-34,41,46H,4,7-8,14,20-22H2,1-2H3,(H,44,45) |
| InChIKey | XKVDMACCUYUGOB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|