C39H37N3O7 — CID 3614298
3-[6-(2-hydroxy-3-prop-2-enylphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 3614298) has the molecular formula C39H37N3O7 and a molecular weight of 659.74 g/mol. Its IUPAC name is 3-[6-(2-hydroxy-3-prop-2-enylphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[6-(2-hydroxy-3-prop-2-enylphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 3614298 |
| Molecular Formula | C39H37N3O7 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.26 |
| IUPAC Name | 3-[6-(2-hydroxy-3-prop-2-enylphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | C=CCc1cccc(C2C3=CCC4C(=O)N(CCC(=O)O)C(=O)C4C3CC3C(=O)N(Nc4ccc(C)cc4)C(=O)C32c2ccccc2)c1O |
| InChI | InChI=1S/C39H37N3O7/c1-3-8-23-9-7-12-28(34(23)45)33-26-17-18-27-32(37(48)41(35(27)46)20-19-31(43)44)29(26)21-30-36(47)42(40-25-15-13-22(2)14-16-25)38(49)39(30,33)24-10-5-4-6-11-24/h3-7,9-17,27,29-30,32-33,40,45H,1,8,18-21H2,2H3,(H,43,44) |
| InChIKey | YZLPEEYIRARGLP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|