C42H37N3O5 — CID 4193006
6-(2-hydroxy-3-prop-2-enylphenyl)-8-(4-methylanilino)-2,6a-diphenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4193006) has the molecular formula C42H37N3O5 and a molecular weight of 663.77 g/mol. Its IUPAC name is 6-(2-hydroxy-3-prop-2-enylphenyl)-8-(4-methylanilino)-2,6a-diphenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(2-hydroxy-3-prop-2-enylphenyl)-8-(4-methylanilino)-2,6a-diphenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4193006 |
| Molecular Formula | C42H37N3O5 |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | 6-(2-hydroxy-3-prop-2-enylphenyl)-8-(4-methylanilino)-2,6a-diphenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | C=CCc1cccc(C2C3=CCC4C(=O)N(c5ccccc5)C(=O)C4C3CC3C(=O)N(Nc4ccc(C)cc4)C(=O)C32c2ccccc2)c1O |
| InChI | InChI=1S/C42H37N3O5/c1-3-11-26-12-10-17-32(37(26)46)36-30-22-23-31-35(40(49)44(38(31)47)29-15-8-5-9-16-29)33(30)24-34-39(48)45(43-28-20-18-25(2)19-21-28)41(50)42(34,36)27-13-6-4-7-14-27/h3-10,12-22,31,33-36,43,46H,1,11,23-24H2,2H3 |
| InChIKey | RKTSVMCXPWCISY-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|