C42H39N3O5 — CID 4641490
2-(4-ethylphenyl)-6-(2-hydroxy-3-methylphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4641490) has the molecular formula C42H39N3O5 and a molecular weight of 665.79 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-6-(2-hydroxy-3-methylphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-ethylphenyl)-6-(2-hydroxy-3-methylphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4641490 |
| Molecular Formula | C42H39N3O5 |
| Molecular Weight | 665.79 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | 2-(4-ethylphenyl)-6-(2-hydroxy-3-methylphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCc1ccc(N2C(=O)C3CC=C4C(CC5C(=O)N(Nc6ccc(C)cc6)C(=O)C5(c5ccccc5)C4c4cccc(C)c4O)C3C2=O)cc1 |
| InChI | InChI=1S/C42H39N3O5/c1-4-26-15-19-29(20-16-26)44-38(47)31-22-21-30-33(35(31)40(44)49)23-34-39(48)45(43-28-17-13-24(2)14-18-28)41(50)42(34,27-10-6-5-7-11-27)36(30)32-12-8-9-25(3)37(32)46/h5-21,31,33-36,43,46H,4,22-23H2,1-3H3 |
| InChIKey | IFLBMJLULYESHM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.79 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|