C43H39FN4O6 — CID 4648941
6-(3-fluoro-2-hydroxyphenyl)-8-(4-methylanilino)-2-(4-morpholin-4-ylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4648941) has the molecular formula C43H39FN4O6 and a molecular weight of 726.81 g/mol. Its IUPAC name is 6-(3-fluoro-2-hydroxyphenyl)-8-(4-methylanilino)-2-(4-morpholin-4-ylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(3-fluoro-2-hydroxyphenyl)-8-(4-methylanilino)-2-(4-morpholin-4-ylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4648941 |
| Molecular Formula | C43H39FN4O6 |
| Molecular Weight | 726.81 g/mol |
| Exact Mass | 726.29 |
| IUPAC Name | 6-(3-fluoro-2-hydroxyphenyl)-8-(4-methylanilino)-2-(4-morpholin-4-ylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1ccc(NN2C(=O)C3CC4C(=CCC5C(=O)N(c6ccc(N7CCOCC7)cc6)C(=O)C54)C(c4cccc(F)c4O)C3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C43H39FN4O6/c1-25-10-12-27(13-11-25)45-48-40(51)34-24-33-30(37(32-8-5-9-35(44)38(32)49)43(34,42(48)53)26-6-3-2-4-7-26)18-19-31-36(33)41(52)47(39(31)50)29-16-14-28(15-17-29)46-20-22-54-23-21-46/h2-18,31,33-34,36-37,45,49H,19-24H2,1H3 |
| InChIKey | CANWBISJAUFTSP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.81 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|