C44H42N4O7 — CID 4293575
6-(4-hydroxy-3-methoxyphenyl)-8-(4-methylanilino)-2-(4-morpholin-4-ylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4293575) has the molecular formula C44H42N4O7 and a molecular weight of 738.84 g/mol. Its IUPAC name is 6-(4-hydroxy-3-methoxyphenyl)-8-(4-methylanilino)-2-(4-morpholin-4-ylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(4-hydroxy-3-methoxyphenyl)-8-(4-methylanilino)-2-(4-morpholin-4-ylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4293575 |
| Molecular Formula | C44H42N4O7 |
| Molecular Weight | 738.84 g/mol |
| Exact Mass | 738.31 |
| IUPAC Name | 6-(4-hydroxy-3-methoxyphenyl)-8-(4-methylanilino)-2-(4-morpholin-4-ylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5ccc(N6CCOCC6)cc5)C(=O)C4C3CC3C(=O)N(Nc4ccc(C)cc4)C(=O)C32c2ccccc2)ccc1O |
| InChI | InChI=1S/C44H42N4O7/c1-26-8-11-29(12-9-26)45-48-41(51)35-25-34-32(39(27-10-19-36(49)37(24-27)54-2)44(35,43(48)53)28-6-4-3-5-7-28)17-18-33-38(34)42(52)47(40(33)50)31-15-13-30(14-16-31)46-20-22-55-23-21-46/h3-17,19,24,33-35,38-39,45,49H,18,20-23,25H2,1-2H3 |
| InChIKey | LUDWCEYHGFLPEJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.84 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|