C40H34IN3O5 — CID 4199933
6-(4-hydroxy-3-methylphenyl)-2-(4-iodophenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4199933) has the molecular formula C40H34IN3O5 and a molecular weight of 763.63 g/mol. Its IUPAC name is 6-(4-hydroxy-3-methylphenyl)-2-(4-iodophenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(4-hydroxy-3-methylphenyl)-2-(4-iodophenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4199933 |
| Molecular Formula | C40H34IN3O5 |
| Molecular Weight | 763.63 g/mol |
| Exact Mass | 763.15 |
| IUPAC Name | 6-(4-hydroxy-3-methylphenyl)-2-(4-iodophenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1ccc(NN2C(=O)C3CC4C(=CCC5C(=O)N(c6ccc(I)cc6)C(=O)C54)C(c4ccc(O)c(C)c4)C3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C40H34IN3O5/c1-22-8-13-27(14-9-22)42-44-37(47)32-21-31-29(17-18-30-34(31)38(48)43(36(30)46)28-15-11-26(41)12-16-28)35(24-10-19-33(45)23(2)20-24)40(32,39(44)49)25-6-4-3-5-7-25/h3-17,19-20,30-32,34-35,42,45H,18,21H2,1-2H3 |
| InChIKey | AVTWYABNIXBANA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|