C45H37ClN4O5 — CID 5010011
2-(4-anilinophenyl)-6-(5-chloro-2-hydroxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5010011) has the molecular formula C45H37ClN4O5 and a molecular weight of 749.27 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-6-(5-chloro-2-hydroxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-anilinophenyl)-6-(5-chloro-2-hydroxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5010011 |
| Molecular Formula | C45H37ClN4O5 |
| Molecular Weight | 749.27 g/mol |
| Exact Mass | 748.25 |
| IUPAC Name | 2-(4-anilinophenyl)-6-(5-chloro-2-hydroxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1ccc(NN2C(=O)C3CC4C(=CCC5C(=O)N(c6ccc(Nc7ccccc7)cc6)C(=O)C54)C(c4cc(Cl)ccc4O)C3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C45H37ClN4O5/c1-26-12-15-31(16-13-26)48-50-42(53)37-25-35-33(40(36-24-28(46)14-23-38(36)51)45(37,44(50)55)27-8-4-2-5-9-27)21-22-34-39(35)43(54)49(41(34)52)32-19-17-30(18-20-32)47-29-10-6-3-7-11-29/h2-21,23-24,34-35,37,39-40,47-48,51H,22,25H2,1H3 |
| InChIKey | VIHKESBQZZUWKI-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.27 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|