C36H33N3O7 — CID 6652675
methyl (3aS,6R,6aS,9aR,10aS,10bR)-6-(4-hydroxy-3-methylphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 6652675) has the molecular formula C36H33N3O7 and a molecular weight of 619.67 g/mol. Its IUPAC name is methyl (3aS,6R,6aS,9aR,10aS,10bR)-6-(4-hydroxy-3-methylphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,6R,6aS,9aR,10aS,10bR)-6-(4-hydroxy-3-methylphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 6652675 |
| Molecular Formula | C36H33N3O7 |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.23 |
| IUPAC Name | methyl (3aS,6R,6aS,9aR,10aS,10bR)-6-(4-hydroxy-3-methylphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)N(Nc4ccc(C)cc4)C(=O)[C@@]2(c2ccccc2)[C@H]3c2ccc(O)c(C)c2)C1=O |
| InChI | InChI=1S/C36H33N3O7/c1-19-9-12-23(13-10-19)37-39-32(42)27-18-26-24(14-15-25-29(26)33(43)38(31(25)41)35(45)46-3)30(21-11-16-28(40)20(2)17-21)36(27,34(39)44)22-7-5-4-6-8-22/h4-14,16-17,25-27,29-30,37,40H,15,18H2,1-3H3/t25-,26+,27-,29-,30-,36+/m0/s1 |
| InChIKey | IVDAYBYLJKLSHS-VOWDQIHSSA-N |
| XLogP | 4.76 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|