C33H28FN3O6 — CID 4062747
6-(3-fluoro-4-hydroxyphenyl)-2-hydroxy-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4062747) has the molecular formula C33H28FN3O6 and a molecular weight of 581.60 g/mol. Its IUPAC name is 6-(3-fluoro-4-hydroxyphenyl)-2-hydroxy-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(3-fluoro-4-hydroxyphenyl)-2-hydroxy-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4062747 |
| Molecular Formula | C33H28FN3O6 |
| Molecular Weight | 581.60 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 6-(3-fluoro-4-hydroxyphenyl)-2-hydroxy-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1ccc(NN2C(=O)C3CC4C(=CCC5C(=O)N(O)C(=O)C54)C(c4ccc(O)c(F)c4)C3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C33H28FN3O6/c1-17-7-10-20(11-8-17)35-36-30(40)24-16-23-21(12-13-22-27(23)31(41)37(43)29(22)39)28(18-9-14-26(38)25(34)15-18)33(24,32(36)42)19-5-3-2-4-6-19/h2-12,14-15,22-24,27-28,35,38,43H,13,16H2,1H3 |
| InChIKey | KZAJSGLYISAOFS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|