C35H33N3O8 — CID 5062968
2-hydroxy-6-(4-hydroxy-3,5-dimethoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5062968) has the molecular formula C35H33N3O8 and a molecular weight of 623.66 g/mol. Its IUPAC name is 2-hydroxy-6-(4-hydroxy-3,5-dimethoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-hydroxy-6-(4-hydroxy-3,5-dimethoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5062968 |
| Molecular Formula | C35H33N3O8 |
| Molecular Weight | 623.66 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | 2-hydroxy-6-(4-hydroxy-3,5-dimethoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(O)C(=O)C4C3CC3C(=O)N(Nc4ccc(C)cc4)C(=O)C32c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C35H33N3O8/c1-18-9-11-21(12-10-18)36-37-32(41)25-17-24-22(13-14-23-28(24)33(42)38(44)31(23)40)29(19-15-26(45-2)30(39)27(16-19)46-3)35(25,34(37)43)20-7-5-4-6-8-20/h4-13,15-16,23-25,28-29,36,39,44H,14,17H2,1-3H3 |
| InChIKey | AHZUZJGBYFYFRU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.66 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|