C41H38BN3O9 — CID 3528132
[3-[6-(4-hydroxy-3,5-dimethoxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 3528132) has the molecular formula C41H38BN3O9 and a molecular weight of 727.58 g/mol. Its IUPAC name is [3-[6-(4-hydroxy-3,5-dimethoxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[6-(4-hydroxy-3,5-dimethoxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 3528132 |
| Molecular Formula | C41H38BN3O9 |
| Molecular Weight | 727.58 g/mol |
| Exact Mass | 727.27 |
| IUPAC Name | [3-[6-(4-hydroxy-3,5-dimethoxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5cccc(B(O)O)c5)C(=O)C4C3CC3C(=O)N(Nc4ccc(C)cc4)C(=O)C32c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C41H38BN3O9/c1-22-12-14-26(15-13-22)43-45-38(48)31-21-30-28(16-17-29-34(30)39(49)44(37(29)47)27-11-7-10-25(20-27)42(51)52)35(23-18-32(53-2)36(46)33(19-23)54-3)41(31,40(45)50)24-8-5-4-6-9-24/h4-16,18-20,29-31,34-35,43,46,51-52H,17,21H2,1-3H3 |
| InChIKey | IIMOMFDVFXORHF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 165.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|