C39H34BN3O7 — CID 3325834
[3-[6-(3-hydroxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 3325834) has the molecular formula C39H34BN3O7 and a molecular weight of 667.53 g/mol. Its IUPAC name is [3-[6-(3-hydroxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[6-(3-hydroxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 3325834 |
| Molecular Formula | C39H34BN3O7 |
| Molecular Weight | 667.53 g/mol |
| Exact Mass | 667.25 |
| IUPAC Name | [3-[6-(3-hydroxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | Cc1ccc(NN2C(=O)C3CC4C(=CCC5C(=O)N(c6cccc(B(O)O)c6)C(=O)C54)C(c4cccc(O)c4)C3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C39H34BN3O7/c1-22-13-15-26(16-14-22)41-43-36(46)32-21-31-29(17-18-30-33(31)37(47)42(35(30)45)27-11-6-10-25(20-27)40(49)50)34(23-7-5-12-28(44)19-23)39(32,38(43)48)24-8-3-2-4-9-24/h2-17,19-20,30-34,41,44,49-50H,18,21H2,1H3 |
| InChIKey | WLZCZUFOGRAYGV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 147.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|