C41H38BN3O8 — CID 3611845
[3-[6-(3-ethoxy-4-hydroxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 3611845) has the molecular formula C41H38BN3O8 and a molecular weight of 711.58 g/mol. Its IUPAC name is [3-[6-(3-ethoxy-4-hydroxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[6-(3-ethoxy-4-hydroxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 3611845 |
| Molecular Formula | C41H38BN3O8 |
| Molecular Weight | 711.58 g/mol |
| Exact Mass | 711.28 |
| IUPAC Name | [3-[6-(3-ethoxy-4-hydroxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(c5cccc(B(O)O)c5)C(=O)C4C3CC3C(=O)N(Nc4ccc(C)cc4)C(=O)C32c2ccccc2)ccc1O |
| InChI | InChI=1S/C41H38BN3O8/c1-3-53-34-20-24(14-19-33(34)46)36-29-17-18-30-35(39(49)44(37(30)47)28-11-7-10-26(21-28)42(51)52)31(29)22-32-38(48)45(43-27-15-12-23(2)13-16-27)40(50)41(32,36)25-8-5-4-6-9-25/h4-17,19-21,30-32,35-36,43,46,51-52H,3,18,22H2,1-2H3 |
| InChIKey | ONMLQIYCCONYSN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 156.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|