C34H31N3O5 — CID 5099527
6-(2-hydroxy-3-methylphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5099527) has the molecular formula C34H31N3O5 and a molecular weight of 561.64 g/mol. Its IUPAC name is 6-(2-hydroxy-3-methylphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(2-hydroxy-3-methylphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5099527 |
| Molecular Formula | C34H31N3O5 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | 6-(2-hydroxy-3-methylphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1ccc(NN2C(=O)C3CC4C(=CCC5C(=O)NC(=O)C54)C(c4cccc(C)c4O)C3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C34H31N3O5/c1-18-11-13-21(14-12-18)36-37-32(41)26-17-25-22(15-16-23-27(25)31(40)35-30(23)39)28(24-10-6-7-19(2)29(24)38)34(26,33(37)42)20-8-4-3-5-9-20/h3-15,23,25-28,36,38H,16-17H2,1-2H3,(H,35,39,40) |
| InChIKey | MXYLSFLJBXFUAA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|