C33H29N3O5 — CID 5054878
6-(4-hydroxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5054878) has the molecular formula C33H29N3O5 and a molecular weight of 547.61 g/mol. Its IUPAC name is 6-(4-hydroxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(4-hydroxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5054878 |
| Molecular Formula | C33H29N3O5 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 6-(4-hydroxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1ccc(NN2C(=O)C3CC4C(=CCC5C(=O)NC(=O)C54)C(c4ccc(O)cc4)C3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C33H29N3O5/c1-18-7-11-21(12-8-18)35-36-31(40)26-17-25-23(15-16-24-27(25)30(39)34-29(24)38)28(19-9-13-22(37)14-10-19)33(26,32(36)41)20-5-3-2-4-6-20/h2-15,24-28,35,37H,16-17H2,1H3,(H,34,38,39) |
| InChIKey | IKHUEZBJYKVRIR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|