C37H37N3O6 — CID 6653807
(3aS,6S,6aS,9aR,10aS,10bR)-2-ethyl-6-[4-(2-hydroxyethoxy)phenyl]-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6653807) has the molecular formula C37H37N3O6 and a molecular weight of 619.72 g/mol. Its IUPAC name is (3aS,6S,6aS,9aR,10aS,10bR)-2-ethyl-6-[4-(2-hydroxyethoxy)phenyl]-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6S,6aS,9aR,10aS,10bR)-2-ethyl-6-[4-(2-hydroxyethoxy)phenyl]-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6653807 |
| Molecular Formula | C37H37N3O6 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | (3aS,6S,6aS,9aR,10aS,10bR)-2-ethyl-6-[4-(2-hydroxyethoxy)phenyl]-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCN1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)N(Nc4ccc(C)cc4)C(=O)[C@@]2(c2ccccc2)[C@H]3c2ccc(OCCO)cc2)C1=O |
| InChI | InChI=1S/C37H37N3O6/c1-3-39-33(42)28-18-17-27-29(31(28)35(39)44)21-30-34(43)40(38-25-13-9-22(2)10-14-25)36(45)37(30,24-7-5-4-6-8-24)32(27)23-11-15-26(16-12-23)46-20-19-41/h4-17,28-32,38,41H,3,18-21H2,1-2H3/t28-,29+,30-,31-,32-,37+/m0/s1 |
| InChIKey | RUUAETUXQZAJNV-RZLJCCINSA-N |
| XLogP | 4.37 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|