C34H33N3O6 — CID 6653655
(3aS,6S,6aS,9aR,10aS,10bR)-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6653655) has the molecular formula C34H33N3O6 and a molecular weight of 579.65 g/mol. Its IUPAC name is (3aS,6S,6aS,9aR,10aS,10bR)-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6S,6aS,9aR,10aS,10bR)-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6653655 |
| Molecular Formula | C34H33N3O6 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | (3aS,6S,6aS,9aR,10aS,10bR)-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCN1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)N(Nc4ccc(C)cc4)C(=O)[C@@]2(c2ccccc2)[C@H]3c2ccc(CO)o2)C1=O |
| InChI | InChI=1S/C34H33N3O6/c1-3-36-30(39)24-15-14-23-25(28(24)32(36)41)17-26-31(40)37(35-21-11-9-19(2)10-12-21)33(42)34(26,20-7-5-4-6-8-20)29(23)27-16-13-22(18-38)43-27/h4-14,16,24-26,28-29,35,38H,3,15,17-18H2,1-2H3/t24-,25+,26-,28-,29+,34+/m0/s1 |
| InChIKey | ANAKRUDRDYQUFN-DRBRCFDKSA-N |
| XLogP | 4.09 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|