C34H31Cl2N3O7 — CID 5139385
8-(2,4-dichloroanilino)-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5139385) has the molecular formula C34H31Cl2N3O7 and a molecular weight of 664.54 g/mol. Its IUPAC name is 8-(2,4-dichloroanilino)-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(2,4-dichloroanilino)-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5139385 |
| Molecular Formula | C34H31Cl2N3O7 |
| Molecular Weight | 664.54 g/mol |
| Exact Mass | 663.15 |
| IUPAC Name | 8-(2,4-dichloroanilino)-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCN1C(=O)C2CC=C3C(CC4C(=O)N(Nc5ccc(Cl)cc5Cl)C(=O)C4(c4ccc(OC)cc4)C3c3ccc(CO)o3)C2C1=O |
| InChI | InChI=1S/C34H31Cl2N3O7/c1-3-38-30(41)22-11-10-21-23(28(22)32(38)43)15-24-31(42)39(37-26-12-6-18(35)14-25(26)36)33(44)34(24,17-4-7-19(45-2)8-5-17)29(21)27-13-9-20(16-40)46-27/h4-10,12-14,22-24,28-29,37,40H,3,11,15-16H2,1-2H3 |
| InChIKey | MXBKROGYBSMTNL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|