C38H37Cl2N3O7 — CID 4650607
8-(2,4-dichloroanilino)-6-(3-ethoxy-4-hydroxyphenyl)-6a-(4-methoxyphenyl)-2-propyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4650607) has the molecular formula C38H37Cl2N3O7 and a molecular weight of 718.63 g/mol. Its IUPAC name is 8-(2,4-dichloroanilino)-6-(3-ethoxy-4-hydroxyphenyl)-6a-(4-methoxyphenyl)-2-propyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(2,4-dichloroanilino)-6-(3-ethoxy-4-hydroxyphenyl)-6a-(4-methoxyphenyl)-2-propyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4650607 |
| Molecular Formula | C38H37Cl2N3O7 |
| Molecular Weight | 718.63 g/mol |
| Exact Mass | 717.20 |
| IUPAC Name | 8-(2,4-dichloroanilino)-6-(3-ethoxy-4-hydroxyphenyl)-6a-(4-methoxyphenyl)-2-propyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCCN1C(=O)C2CC=C3C(CC4C(=O)N(Nc5ccc(Cl)cc5Cl)C(=O)C4(c4ccc(OC)cc4)C3c3ccc(O)c(OCC)c3)C2C1=O |
| InChI | InChI=1S/C38H37Cl2N3O7/c1-4-16-42-34(45)25-13-12-24-26(32(25)36(42)47)19-27-35(46)43(41-29-14-9-22(39)18-28(29)40)37(48)38(27,21-7-10-23(49-3)11-8-21)33(24)20-6-15-30(44)31(17-20)50-5-2/h6-12,14-15,17-18,25-27,32-33,41,44H,4-5,13,16,19H2,1-3H3 |
| InChIKey | KFWLPBDIRRPHFD-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.63 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|