C40H32BrCl2N3O7 — CID 5212062
2-(4-bromophenyl)-8-(2,4-dichloroanilino)-6-(4-hydroxy-3-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5212062) has the molecular formula C40H32BrCl2N3O7 and a molecular weight of 817.52 g/mol. Its IUPAC name is 2-(4-bromophenyl)-8-(2,4-dichloroanilino)-6-(4-hydroxy-3-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-bromophenyl)-8-(2,4-dichloroanilino)-6-(4-hydroxy-3-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5212062 |
| Molecular Formula | C40H32BrCl2N3O7 |
| Molecular Weight | 817.52 g/mol |
| Exact Mass | 815.08 |
| IUPAC Name | 2-(4-bromophenyl)-8-(2,4-dichloroanilino)-6-(4-hydroxy-3-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)N(c5ccc(Br)cc5)C(=O)C42)C3c2ccc(O)c(OC)c2)cc1 |
| InChI | InChI=1S/C40H32BrCl2N3O7/c1-52-25-11-4-21(5-12-25)40-29(37(49)46(39(40)51)44-31-15-8-23(42)18-30(31)43)19-28-26(35(40)20-3-16-32(47)33(17-20)53-2)13-14-27-34(28)38(50)45(36(27)48)24-9-6-22(41)7-10-24/h3-13,15-18,27-29,34-35,44,47H,14,19H2,1-2H3 |
| InChIKey | SFBXYTAXKKIIKX-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.52 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|