C43H32Cl3N3O6 — CID 4195147
2-(4-chlorophenyl)-8-(2,4-dichloroanilino)-6-(4-hydroxynaphthalen-1-yl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4195147) has the molecular formula C43H32Cl3N3O6 and a molecular weight of 793.10 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-8-(2,4-dichloroanilino)-6-(4-hydroxynaphthalen-1-yl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-chlorophenyl)-8-(2,4-dichloroanilino)-6-(4-hydroxynaphthalen-1-yl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4195147 |
| Molecular Formula | C43H32Cl3N3O6 |
| Molecular Weight | 793.10 g/mol |
| Exact Mass | 791.14 |
| IUPAC Name | 2-(4-chlorophenyl)-8-(2,4-dichloroanilino)-6-(4-hydroxynaphthalen-1-yl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)N(c5ccc(Cl)cc5)C(=O)C42)C3c2ccc(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C43H32Cl3N3O6/c1-55-26-13-6-22(7-14-26)43-33(40(52)49(42(43)54)47-35-18-10-24(45)20-34(35)46)21-32-30(38(43)29-17-19-36(50)28-5-3-2-4-27(28)29)15-16-31-37(32)41(53)48(39(31)51)25-11-8-23(44)9-12-25/h2-15,17-20,31-33,37-38,47,50H,16,21H2,1H3 |
| InChIKey | MVDUBHLRPAPLRR-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.10 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|