C41H37Cl2N3O6 — CID 4148385
2-tert-butyl-8-(2,4-dichloroanilino)-6-(4-hydroxynaphthalen-1-yl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4148385) has the molecular formula C41H37Cl2N3O6 and a molecular weight of 738.67 g/mol. Its IUPAC name is 2-tert-butyl-8-(2,4-dichloroanilino)-6-(4-hydroxynaphthalen-1-yl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-tert-butyl-8-(2,4-dichloroanilino)-6-(4-hydroxynaphthalen-1-yl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4148385 |
| Molecular Formula | C41H37Cl2N3O6 |
| Molecular Weight | 738.67 g/mol |
| Exact Mass | 737.21 |
| IUPAC Name | 2-tert-butyl-8-(2,4-dichloroanilino)-6-(4-hydroxynaphthalen-1-yl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)N(C(C)(C)C)C(=O)C42)C3c2ccc(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C41H37Cl2N3O6/c1-40(2,3)45-36(48)28-15-14-27-29(34(28)38(45)50)20-30-37(49)46(44-32-17-11-22(42)19-31(32)43)39(51)41(30,21-9-12-23(52-4)13-10-21)35(27)26-16-18-33(47)25-8-6-5-7-24(25)26/h5-14,16-19,28-30,34-35,44,47H,15,20H2,1-4H3 |
| InChIKey | MXRCEBOMUAOYGJ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.67 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|