C41H35Cl2N3O8 — CID 3594837
4-[8-(2,4-dichloroanilino)-6-(4-hydroxynaphthalen-1-yl)-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 3594837) has the molecular formula C41H35Cl2N3O8 and a molecular weight of 768.65 g/mol. Its IUPAC name is 4-[8-(2,4-dichloroanilino)-6-(4-hydroxynaphthalen-1-yl)-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[8-(2,4-dichloroanilino)-6-(4-hydroxynaphthalen-1-yl)-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 3594837 |
| Molecular Formula | C41H35Cl2N3O8 |
| Molecular Weight | 768.65 g/mol |
| Exact Mass | 767.18 |
| IUPAC Name | 4-[8-(2,4-dichloroanilino)-6-(4-hydroxynaphthalen-1-yl)-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)N(CCCC(=O)O)C(=O)C42)C3c2ccc(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C41H35Cl2N3O8/c1-54-23-11-8-21(9-12-23)41-30(38(51)46(40(41)53)44-32-16-10-22(42)19-31(32)43)20-29-27(36(41)26-15-17-33(47)25-6-3-2-5-24(25)26)13-14-28-35(29)39(52)45(37(28)50)18-4-7-34(48)49/h2-3,5-6,8-13,15-17,19,28-30,35-36,44,47H,4,7,14,18,20H2,1H3,(H,48,49) |
| InChIKey | ZMWWLCURVNXFRJ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|