C41H37N3O7 — CID 5149786
4-[6-(4-hydroxynaphthalen-1-yl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 5149786) has the molecular formula C41H37N3O7 and a molecular weight of 683.76 g/mol. Its IUPAC name is 4-[6-(4-hydroxynaphthalen-1-yl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6-(4-hydroxynaphthalen-1-yl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 5149786 |
| Molecular Formula | C41H37N3O7 |
| Molecular Weight | 683.76 g/mol |
| Exact Mass | 683.26 |
| IUPAC Name | 4-[6-(4-hydroxynaphthalen-1-yl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | Cc1ccc(NN2C(=O)C3CC4C(=CCC5C(=O)N(CCCC(=O)O)C(=O)C54)C(c4ccc(O)c5ccccc45)C3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C41H37N3O7/c1-23-13-15-25(16-14-23)42-44-38(49)32-22-31-29(17-18-30-35(31)39(50)43(37(30)48)21-7-12-34(46)47)36(41(32,40(44)51)24-8-3-2-4-9-24)28-19-20-33(45)27-11-6-5-10-26(27)28/h2-6,8-11,13-17,19-20,30-32,35-36,42,45H,7,12,18,21-22H2,1H3,(H,46,47) |
| InChIKey | BOUIKUYMNJEXJZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.76 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|