C39H31Cl2N3O8 — CID 4576213
methyl 8-(2,4-dichloroanilino)-6-(1-hydroxynaphthalen-2-yl)-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 4576213) has the molecular formula C39H31Cl2N3O8 and a molecular weight of 740.60 g/mol. Its IUPAC name is methyl 8-(2,4-dichloroanilino)-6-(1-hydroxynaphthalen-2-yl)-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 8-(2,4-dichloroanilino)-6-(1-hydroxynaphthalen-2-yl)-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 4576213 |
| Molecular Formula | C39H31Cl2N3O8 |
| Molecular Weight | 740.60 g/mol |
| Exact Mass | 739.15 |
| IUPAC Name | methyl 8-(2,4-dichloroanilino)-6-(1-hydroxynaphthalen-2-yl)-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4C(=O)N(Nc5ccc(Cl)cc5Cl)C(=O)C4(c4ccc(OC)cc4)C3c3ccc4ccccc4c3O)C2C1=O |
| InChI | InChI=1S/C39H31Cl2N3O8/c1-51-22-11-8-20(9-12-22)39-28(35(47)44(37(39)49)42-30-16-10-21(40)17-29(30)41)18-27-24(14-15-25-31(27)36(48)43(34(25)46)38(50)52-2)32(39)26-13-7-19-5-3-4-6-23(19)33(26)45/h3-14,16-17,25,27-28,31-32,42,45H,15,18H2,1-2H3 |
| InChIKey | PJSMUECPCFYSIV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.60 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|