C37H33Cl2N3O8 — CID 5015755
methyl 8-(2,4-dichloroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 5015755) has the molecular formula C37H33Cl2N3O8 and a molecular weight of 718.59 g/mol. Its IUPAC name is methyl 8-(2,4-dichloroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 8-(2,4-dichloroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 5015755 |
| Molecular Formula | C37H33Cl2N3O8 |
| Molecular Weight | 718.59 g/mol |
| Exact Mass | 717.16 |
| IUPAC Name | methyl 8-(2,4-dichloroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4C(=O)N(Nc5ccc(Cl)cc5Cl)C(=O)C4(c4ccc(OC)cc4)C3c3cc(C)c(O)c(C)c3)C2C1=O |
| InChI | InChI=1S/C37H33Cl2N3O8/c1-17-13-19(14-18(2)31(17)43)30-23-10-11-24-29(34(46)41(32(24)44)36(48)50-4)25(23)16-26-33(45)42(40-28-12-7-21(38)15-27(28)39)35(47)37(26,30)20-5-8-22(49-3)9-6-20/h5-10,12-15,24-26,29-30,40,43H,11,16H2,1-4H3 |
| InChIKey | PUNRMDUWSGUZOC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|