C41H41Cl2N3O6 — CID 5059538
2-cyclohexyl-8-(2,4-dichloroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5059538) has the molecular formula C41H41Cl2N3O6 and a molecular weight of 742.70 g/mol. Its IUPAC name is 2-cyclohexyl-8-(2,4-dichloroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-cyclohexyl-8-(2,4-dichloroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5059538 |
| Molecular Formula | C41H41Cl2N3O6 |
| Molecular Weight | 742.70 g/mol |
| Exact Mass | 741.24 |
| IUPAC Name | 2-cyclohexyl-8-(2,4-dichloroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)N(C5CCCCC5)C(=O)C42)C3c2cc(C)c(O)c(C)c2)cc1 |
| InChI | InChI=1S/C41H41Cl2N3O6/c1-21-17-23(18-22(2)36(21)47)35-28-14-15-29-34(39(50)45(37(29)48)26-7-5-4-6-8-26)30(28)20-31-38(49)46(44-33-16-11-25(42)19-32(33)43)40(51)41(31,35)24-9-12-27(52-3)13-10-24/h9-14,16-19,26,29-31,34-35,44,47H,4-8,15,20H2,1-3H3 |
| InChIKey | WMIIPFFEUYYLNO-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.70 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|