C35H31Cl2N3O6 — CID 3485283
8-(2,4-dichloroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3485283) has the molecular formula C35H31Cl2N3O6 and a molecular weight of 660.55 g/mol. Its IUPAC name is 8-(2,4-dichloroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(2,4-dichloroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3485283 |
| Molecular Formula | C35H31Cl2N3O6 |
| Molecular Weight | 660.55 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | 8-(2,4-dichloroanilino)-6-(4-hydroxy-3,5-dimethylphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)NC(=O)C42)C3c2cc(C)c(O)c(C)c2)cc1 |
| InChI | InChI=1S/C35H31Cl2N3O6/c1-16-12-18(13-17(2)30(16)41)29-22-9-10-23-28(32(43)38-31(23)42)24(22)15-25-33(44)40(39-27-11-6-20(36)14-26(27)37)34(45)35(25,29)19-4-7-21(46-3)8-5-19/h4-9,11-14,23-25,28-29,39,41H,10,15H2,1-3H3,(H,38,42,43) |
| InChIKey | MJYSTZQMGZCJIK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|