C36H29Cl2N3O7 — CID 4168257
8-(2,4-dichloroanilino)-6-(6-hydroxy-4H-chromen-3-yl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4168257) has the molecular formula C36H29Cl2N3O7 and a molecular weight of 686.55 g/mol. Its IUPAC name is 8-(2,4-dichloroanilino)-6-(6-hydroxy-4H-chromen-3-yl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(2,4-dichloroanilino)-6-(6-hydroxy-4H-chromen-3-yl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4168257 |
| Molecular Formula | C36H29Cl2N3O7 |
| Molecular Weight | 686.55 g/mol |
| Exact Mass | 685.14 |
| IUPAC Name | 8-(2,4-dichloroanilino)-6-(6-hydroxy-4H-chromen-3-yl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)NC(=O)C42)C3C2=COc3ccc(O)cc3C2)cc1 |
| InChI | InChI=1S/C36H29Cl2N3O7/c1-47-22-6-2-19(3-7-22)36-26(34(45)41(35(36)46)40-28-10-4-20(37)14-27(28)38)15-25-23(8-9-24-30(25)33(44)39-32(24)43)31(36)18-12-17-13-21(42)5-11-29(17)48-16-18/h2-8,10-11,13-14,16,24-26,30-31,40,42H,9,12,15H2,1H3,(H,39,43,44) |
| InChIKey | ZSJUYQNVTMCFTM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|