C34H29Cl2N3O7 — CID 3594836
8-(2,4-dichloroanilino)-6-(4-hydroxy-2-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3594836) has the molecular formula C34H29Cl2N3O7 and a molecular weight of 662.53 g/mol. Its IUPAC name is 8-(2,4-dichloroanilino)-6-(4-hydroxy-2-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(2,4-dichloroanilino)-6-(4-hydroxy-2-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3594836 |
| Molecular Formula | C34H29Cl2N3O7 |
| Molecular Weight | 662.53 g/mol |
| Exact Mass | 661.14 |
| IUPAC Name | 8-(2,4-dichloroanilino)-6-(4-hydroxy-2-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)NC(=O)C42)C3c2ccc(O)cc2OC)cc1 |
| InChI | InChI=1S/C34H29Cl2N3O7/c1-45-19-7-3-16(4-8-19)34-24(32(43)39(33(34)44)38-26-12-5-17(35)13-25(26)36)15-23-20(10-11-22-28(23)31(42)37-30(22)41)29(34)21-9-6-18(40)14-27(21)46-2/h3-10,12-14,22-24,28-29,38,40H,11,15H2,1-2H3,(H,37,41,42) |
| InChIKey | ZZRWKUDVIMPJFM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|