C42H35Cl2N3O7 — CID 4195014
8-(2,4-dichloroanilino)-2-(4-ethenylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4195014) has the molecular formula C42H35Cl2N3O7 and a molecular weight of 764.66 g/mol. Its IUPAC name is 8-(2,4-dichloroanilino)-2-(4-ethenylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(2,4-dichloroanilino)-2-(4-ethenylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4195014 |
| Molecular Formula | C42H35Cl2N3O7 |
| Molecular Weight | 764.66 g/mol |
| Exact Mass | 763.19 |
| IUPAC Name | 8-(2,4-dichloroanilino)-2-(4-ethenylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | C=Cc1ccc(N2C(=O)C3CC=C4C(CC5C(=O)N(Nc6ccc(Cl)cc6Cl)C(=O)C5(c5ccc(OC)cc5)C4c4ccc(O)cc4OC)C3C2=O)cc1 |
| InChI | InChI=1S/C42H35Cl2N3O7/c1-4-22-5-10-25(11-6-22)46-38(49)30-17-16-28-31(36(30)40(46)51)21-32-39(50)47(45-34-18-9-24(43)19-33(34)44)41(52)42(32,23-7-13-27(53-2)14-8-23)37(28)29-15-12-26(48)20-35(29)54-3/h4-16,18-20,30-32,36-37,45,48H,1,17,21H2,2-3H3 |
| InChIKey | IQRYQEQKNAHGRR-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.66 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|