C36H28ClFN4O7 — CID 4143456
6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide (PubChem CID 4143456) has the molecular formula C36H28ClFN4O7 and a molecular weight of 683.09 g/mol. Its IUPAC name is 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide.
| Compound Name | 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 4143456 |
| Molecular Formula | C36H28ClFN4O7 |
| Molecular Weight | 683.09 g/mol |
| Exact Mass | 682.16 |
| IUPAC Name | 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
| SMILES | NC(=O)N1C(=O)C2CC=C3C(CC4C(=O)N(Nc5ccc(F)cc5)C(=O)C4(c4ccc(Cl)cc4)C3C3=COc4ccc(O)cc4C3)C2C1=O |
| InChI | InChI=1S/C36H28ClFN4O7/c37-20-3-1-19(2-4-20)36-27(32(45)42(34(36)47)40-22-7-5-21(38)6-8-22)15-26-24(10-11-25-29(26)33(46)41(31(25)44)35(39)48)30(36)18-13-17-14-23(43)9-12-28(17)49-16-18/h1-10,12,14,16,25-27,29-30,40,43H,11,13,15H2,(H2,39,48) |
| InChIKey | ZWWGLYUVQPFHCI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 159.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.09 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|