C41H33Cl2N3O7 — CID 4319019
2-(4-acetylphenyl)-8-(2,4-dichloroanilino)-6-(4-hydroxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4319019) has the molecular formula C41H33Cl2N3O7 and a molecular weight of 750.64 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-8-(2,4-dichloroanilino)-6-(4-hydroxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-acetylphenyl)-8-(2,4-dichloroanilino)-6-(4-hydroxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4319019 |
| Molecular Formula | C41H33Cl2N3O7 |
| Molecular Weight | 750.64 g/mol |
| Exact Mass | 749.17 |
| IUPAC Name | 2-(4-acetylphenyl)-8-(2,4-dichloroanilino)-6-(4-hydroxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)N(c5ccc(C(C)=O)cc5)C(=O)C42)C3c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C41H33Cl2N3O7/c1-21(47)22-3-10-26(11-4-22)45-37(49)30-17-16-29-31(35(30)39(45)51)20-32-38(50)46(44-34-18-9-25(42)19-33(34)43)40(52)41(32,24-7-14-28(53-2)15-8-24)36(29)23-5-12-27(48)13-6-23/h3-16,18-19,30-32,35-36,44,48H,17,20H2,1-2H3 |
| InChIKey | WIIAWILPWWGOMH-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.64 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|