C41H35Cl2N3O7 — CID 5046869
2-benzyl-8-(2,4-dichloroanilino)-6-(3-hydroxy-4-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5046869) has the molecular formula C41H35Cl2N3O7 and a molecular weight of 752.65 g/mol. Its IUPAC name is 2-benzyl-8-(2,4-dichloroanilino)-6-(3-hydroxy-4-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-benzyl-8-(2,4-dichloroanilino)-6-(3-hydroxy-4-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5046869 |
| Molecular Formula | C41H35Cl2N3O7 |
| Molecular Weight | 752.65 g/mol |
| Exact Mass | 751.19 |
| IUPAC Name | 2-benzyl-8-(2,4-dichloroanilino)-6-(3-hydroxy-4-methoxyphenyl)-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)N(Cc5ccccc5)C(=O)C42)C3c2ccc(OC)c(O)c2)cc1 |
| InChI | InChI=1S/C41H35Cl2N3O7/c1-52-26-12-9-24(10-13-26)41-30(38(49)46(40(41)51)44-32-16-11-25(42)19-31(32)43)20-29-27(36(41)23-8-17-34(53-2)33(47)18-23)14-15-28-35(29)39(50)45(37(28)48)21-22-6-4-3-5-7-22/h3-14,16-19,28-30,35-36,44,47H,15,20-21H2,1-2H3 |
| InChIKey | CYPYGYUWAYTUSF-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.65 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|