C37H34Cl3N3O7 — CID 4050256
6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(2,4-dichloroanilino)-6a-(4-methoxyphenyl)-2-propyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4050256) has the molecular formula C37H34Cl3N3O7 and a molecular weight of 739.05 g/mol. Its IUPAC name is 6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(2,4-dichloroanilino)-6a-(4-methoxyphenyl)-2-propyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(2,4-dichloroanilino)-6a-(4-methoxyphenyl)-2-propyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4050256 |
| Molecular Formula | C37H34Cl3N3O7 |
| Molecular Weight | 739.05 g/mol |
| Exact Mass | 737.15 |
| IUPAC Name | 6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(2,4-dichloroanilino)-6a-(4-methoxyphenyl)-2-propyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCCN1C(=O)C2CC=C3C(CC4C(=O)N(Nc5ccc(Cl)cc5Cl)C(=O)C4(c4ccc(OC)cc4)C3c3cc(Cl)c(O)c(OC)c3)C2C1=O |
| InChI | InChI=1S/C37H34Cl3N3O7/c1-4-13-42-33(45)23-11-10-22-24(30(23)35(42)47)17-25-34(46)43(41-28-12-7-20(38)16-26(28)39)36(48)37(25,19-5-8-21(49-2)9-6-19)31(22)18-14-27(40)32(44)29(15-18)50-3/h5-10,12,14-16,23-25,30-31,41,44H,4,11,13,17H2,1-3H3 |
| InChIKey | MRRDCWIHHOAYGO-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.05 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|