C39H31Cl2N3O9 — CID 4251049
3-[8-(2,4-dichloroanilino)-6-[5-(hydroxymethyl)furan-2-yl]-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid (PubChem CID 4251049) has the molecular formula C39H31Cl2N3O9 and a molecular weight of 756.60 g/mol. Its IUPAC name is 3-[8-(2,4-dichloroanilino)-6-[5-(hydroxymethyl)furan-2-yl]-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[8-(2,4-dichloroanilino)-6-[5-(hydroxymethyl)furan-2-yl]-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4251049 |
| Molecular Formula | C39H31Cl2N3O9 |
| Molecular Weight | 756.60 g/mol |
| Exact Mass | 755.14 |
| IUPAC Name | 3-[8-(2,4-dichloroanilino)-6-[5-(hydroxymethyl)furan-2-yl]-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)N(c5cccc(C(=O)O)c5)C(=O)C42)C3c2ccc(CO)o2)cc1 |
| InChI | InChI=1S/C39H31Cl2N3O9/c1-52-23-8-5-20(6-9-23)39-28(35(47)44(38(39)51)42-30-13-7-21(40)16-29(30)41)17-27-25(33(39)31-14-10-24(18-45)53-31)11-12-26-32(27)36(48)43(34(26)46)22-4-2-3-19(15-22)37(49)50/h2-11,13-16,26-28,32-33,42,45H,12,17-18H2,1H3,(H,49,50) |
| InChIKey | QVVQEKZQNHDIOX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 166.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|